| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
IMegliMin (hydrochloride) manufacturers
|
| | IMegliMin (hydrochloride) Basic information |
| Product Name: | IMegliMin (hydrochloride) | | Synonyms: | IMegliMin (hydrochloride);(6R)-1,6-Dihydro-N2,N2,6-trimethyl-1,3,5-triazine-2,4-diamine hydrochloride;1,3,5-Triazine-2,4-diamine, 1,6-dihydro-N,N,6-trimethyl-, hydrochloride,(+)-;(4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;EMD 387008 hydrochloride;Imegramine hydrochloride;EMD387008,inhibit,mitochondrial,lowering,insulin,Mitochondrial Metabolism,oral,Imeglimin hydrochloride,ROS,Imeglimin,Inhibitor,Reactive Oxygen Species,function,EMD-387008,sensitivity,EMD 387008,glucose;MegliMin(hydrochloride) | | CAS: | 775351-61-6 | | MF: | C6H14ClN5 | | MW: | 191.66186 | | EINECS: | | | Product Categories: | | | Mol File: | 775351-61-6.mol |  |
| | IMegliMin (hydrochloride) Chemical Properties |
| storage temp. | Store at -20°C | | solubility | ≥29.9 mg/mL in DMSO; ≥50.3 mg/mL in EtOH; ≥62.7 mg/mL in H2O | | form | solid | | color | White to off-white | | InChI | 1S/C6H13N5.ClH/c1-4-8-5(7)10-6(9-4)11(2)3;/h4H,1-3H3,(H3,7,8,9,10);1H/t4-;/m1./s1 | | InChIKey | UXHLCYMTNMEXKZ-PGMHMLKASA-N | | SMILES | Cl.N1[C@@H](N=C(N=C1N(C)C)N)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | IMegliMin (hydrochloride) Usage And Synthesis |
| Uses | R-Imeglimin-D3 Hydrochloride is a labelled salt analog of Imeglimin (CAS# 775351-65-0), which is a novel oral antidiabetic drug for treatment of type 2 diabetes. | | in vivo | Imeglimin (200 mg/kg b.i.d. by oral gavage during the last 6 weeks of HFHSD feeding) significantly decreases hyperglycemia, and restores normal glucose tolerance[1]. | Animal Model: | Male C57BL/6JOlaHsd mice (4 weeks old)[1] | | Dosage: | 200 mg/kg | | Administration: | Oral gavage; b.i.d.; 6 weeks | | Result: | A slight decrease in body weight and food intake associated with some diarrhea was observed but only during the first few days of treatment. |
|
| | IMegliMin (hydrochloride) Preparation Products And Raw materials |
|