|
|
| | 2-Hydroxy-3-fluoro-4-(trifluoromethyl)pyridine Basic information |
| Product Name: | 2-Hydroxy-3-fluoro-4-(trifluoromethyl)pyridine | | Synonyms: | 3-Fluoro-4-(trifluoromethyl)pyridin-2-ol;2-Hydroxy-3-fluoro-4-(trifluoromethyl)pyridine;3-fluoro-4-(trifluoromethyl)-1h-pyridin-2-one;2(1H)-Pyridinone, 3-fluoro-4-(trifluoromethyl)-;doravirine-001;3-Fluoro-4-(trifluoromethyl)-2(1H)-pyridinone;3-fluoro-4-(trifluoromethyl)pyridine-2-ol;doravirine Impurity 4 | | CAS: | 1227594-89-9 | | MF: | C6H3F4NO | | MW: | 181.09 | | EINECS: | | | Product Categories: | | | Mol File: | 1227594-89-9.mol |  |
| | 2-Hydroxy-3-fluoro-4-(trifluoromethyl)pyridine Chemical Properties |
| Boiling point | 189.6±40.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.70±0.10(Predicted) | | form | powder | | color | White | | InChI | 1S/C6H3F4NO/c7-4-3(6(8,9)10)1-2-11-5(4)12/h1-2H,(H,11,12) | | InChIKey | CUVQCPUTFJFSFU-UHFFFAOYSA-N | | SMILES | OC1=C(F)C(C(F)(F)F)=CC=N1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-Hydroxy-3-fluoro-4-(trifluoromethyl)pyridine Usage And Synthesis |
| | 2-Hydroxy-3-fluoro-4-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|