|
|
| | tert-Butyl 2-oxa-5,8-diazaspiro[3.5]nonane-5-carboxylate Basic information |
| | tert-Butyl 2-oxa-5,8-diazaspiro[3.5]nonane-5-carboxylate Chemical Properties |
| Boiling point | 331.8±42.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.24±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H20N2O3/c1-10(2,3)16-9(14)13-5-4-12-6-11(13)7-15-8-11/h12H,4-8H2,1-3H3 | | InChIKey | CMNXNMYNWVAHRR-UHFFFAOYSA-N | | SMILES | C1C2(CNCCN2C(OC(C)(C)C)=O)CO1 |
| | tert-Butyl 2-oxa-5,8-diazaspiro[3.5]nonane-5-carboxylate Usage And Synthesis |
| Uses |
tert-Butyl 2-oxa-5,8-diazaspiro[3.5]nonane-5-carboxylate can be used as a pharmaceutical intermediate.
|
| | tert-Butyl 2-oxa-5,8-diazaspiro[3.5]nonane-5-carboxylate Preparation Products And Raw materials |
|