|
|
| | (-)-1,2-BIS((2S,5S)-2,5-DIETHYLPHOSPHOLANO)ETHANE Basic information | | Reaction |
| Product Name: | (-)-1,2-BIS((2S,5S)-2,5-DIETHYLPHOSPHOLANO)ETHANE | | Synonyms: | (S,S)-ET-BPE;(-)-1,2-BIS((2S,5S)-2,5-DIETHYLPHOSPHOLANO)ETHANE;(-)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]ethane, Kanata purity;(-)-1,2-Bis((2S,5S)-2,5-diethylphospholano)ethane,98+%(S,S)-Et-BPE;(-)-1,2-Bis[(2S,5S)-2,5-diethyl-1-phospholanyl]ethane, 97+%;(-)-1,2-Bis((2S,5S)-2,5-diethylphospholano)ethane (S,S)-Et-BPE;(-)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]ethane, 97% (S,S-Et-BPE);(2S,5S)-1-[2-[(2S,5S)-2,5-diethylphospholan-1-yl]ethyl]-2,5-diethylphospholane | | CAS: | 136779-27-6 | | MF: | C18H36P2 | | MW: | 314.43 | | EINECS: | | | Product Categories: | organophosphine ligand | | Mol File: | 136779-27-6.mol |  |
| | (-)-1,2-BIS((2S,5S)-2,5-DIETHYLPHOSPHOLANO)ETHANE Chemical Properties |
| alpha | -320° ±4° (c 1, hexane) | | Boiling point | 104-106°C 0,5mm | | refractive index | n 20/D 1.5243 | | form | liquid | | color | colorless to pale-yellow | | Sensitive | air sensitive | | InChI | 1S/C18H36P2/c1-5-15-9-10-16(6-2)19(15)13-14-20-17(7-3)11-12-18(20)8-4/h15-18H,5-14H2,1-4H3/t15-,16-,17-,18-/m0/s1 | | InChIKey | QOLRLVPABLMMKI-XSLAGTTESA-N | | SMILES | CC[C@@H]1P(CCP2[C@@H](CC)CC[C@@H]2CC)[C@@H](CC)CC1 |
| Hazard Codes | F | | Risk Statements | 36/37/38-17 | | Safety Statements | 26-36/37/39-6 | | RIDADR | UN 2845 4.2/PG 1 | | WGK Germany | 3 | | Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials | | Hazard Classifications | Pyr. Liq. 1 |
| | (-)-1,2-BIS((2S,5S)-2,5-DIETHYLPHOSPHOLANO)ETHANE Usage And Synthesis |
| Reaction |
- The DUPHOS family of catalysts is highly efficient for the asymmetric hydrogenation of various substituted acetamidoacrylates and enol acetates yielding products of high enantiomeric excesses. Efficient ligand for the asymmetric hydrogenation of tetrasubstituted enamides.
- Forms superior catalysts for asymmetric reductive aminations.
- Catalyst used for the asymmetric hydrogenation of enol phosphonates.
- A novel enantioselective synthesis of β-amino alcohols and 1,2-diamines.
- Ligand for the catalytic asymmetric [4+1] cycloaddition of vinylallenes with CO.
- Ligand for the Rh-catalyzed asymmetric enyne cycloisomerization.
- Catalytic enantioselective addition of dialkylzinc to N-Diphenylphosphinoylimines.
- Palladium catalyzed asymmetric phosphination.

| | Uses | DuPhos and BPE Ligands: Highly Efficient Privileged Ligands |
| | (-)-1,2-BIS((2S,5S)-2,5-DIETHYLPHOSPHOLANO)ETHANE Preparation Products And Raw materials |
|