propan-2-one compound with imidazo[1,2-a]pyridine (1:1) manufacturers
|
| | propan-2-one compound with imidazo[1,2-a]pyridine (1:1) Basic information |
| | propan-2-one compound with imidazo[1,2-a]pyridine (1:1) Chemical Properties |
| density | 1.17±0.1 g/cm3(Predicted) | | pka | 6.46±0.50(Predicted) | | InChI | InChI=1S/C10H10N2O/c1-8(13)6-9-2-3-10-11-4-5-12(10)7-9/h2-5,7H,6H2,1H3 | | InChIKey | KEHXBISWXRCSIL-UHFFFAOYSA-N | | SMILES | C(C1=CN2C=CN=C2C=C1)C(=O)C |
| | propan-2-one compound with imidazo[1,2-a]pyridine (1:1) Usage And Synthesis |
| Uses | 1-(Imidazo[1,2-a]pyridin-6-yl)propan-2-one can be synthesized from 6-Bromoimidazo[1,2-a]pyridine (B696310). |
| | propan-2-one compound with imidazo[1,2-a]pyridine (1:1) Preparation Products And Raw materials |
|