| Company Name: |
commedx Gold |
| Tel: |
1851900025 |
| Email: |
zhanghu@commedx.com |
Nε-acryloyl-L-lysin manufacturers
|
| | Nε-acryloyl-L-lysin Basic information |
| Product Name: | Nε-acryloyl-L-lysin | | Synonyms: | Nε-acryloyl-L-lysin;N6-(1-Oxo-2-propen-1-yl)-L-lysine;N-epsilon-Acryloyl L-Lysine;NSC 288650;2-amino-6-(prop-2-enoylamino)hexanoic acid;L-Lysine, N6-(1-oxo-2-propen-1-yl)-;(S)-6-Acrylamido-2-aminohexanoic acid;N6-acryloyllysine | | CAS: | 48065-82-3 | | MF: | C9H16N2O3 | | MW: | 200.24 | | EINECS: | | | Product Categories: | | | Mol File: | 48065-82-3.mol |  |
| | Nε-acryloyl-L-lysin Chemical Properties |
| Boiling point | 453.9±45.0 °C(Predicted) | | density | 1.132±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 2.53±0.24(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | 2.91°(C=1.00, H2O) | | InChI | InChI=1S/C9H16N2O3/c1-2-8(12)11-6-4-3-5-7(10)9(13)14/h2,7H,1,3-6,10H2,(H,11,12)(H,13,14)/t7-/m0/s1 | | InChIKey | IXKBZVCSFYNRBY-ZETCQYMHSA-N | | SMILES | C(O)(=O)[C@H](CCCCNC(=O)C=C)N |
| | Nε-acryloyl-L-lysin Usage And Synthesis |
| Uses | Nε-acryloyl-L-lysin is a versatile compound that plays a significant role in
bioconjugation and polymer chemistry. This amino acid derivative
features an acryloyl group, making it an excellent candidate for
applications in the synthesis of hydrogels, drug delivery systems, and
biomaterials. |
| | Nε-acryloyl-L-lysin Preparation Products And Raw materials |
|