|
|
| | 3-BroMo-9,9-diphenyl-9H-fluorene Basic information | | Uses |
| | 3-BroMo-9,9-diphenyl-9H-fluorene Chemical Properties |
| Melting point | 221.0 to 225.0 °C | | Boiling point | 472.7±24.0 °C(Predicted) | | density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C25H17Br/c26-20-15-16-24-22(17-20)21-13-7-8-14-23(21)25(24,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17H | | InChIKey | AXVLLFWWMWDULG-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)(C2=CC=CC=C2)C2=C(C=CC=C2)C2=C1C=CC(Br)=C2 |
| | 3-BroMo-9,9-diphenyl-9H-fluorene Usage And Synthesis |
| Uses | 3-Bromo-9,9-diphenyl-9H-fluorene is a useful research chemical. |
| | 3-BroMo-9,9-diphenyl-9H-fluorene Preparation Products And Raw materials |
|