| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | DL-Lysine-1-13C dihydrochloride Basic information |
| | DL-Lysine-1-13C dihydrochloride Chemical Properties |
| Melting point | 190 °C(lit.) | | form | solid | | InChI | 1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/i6+1;; | | InChIKey | JBBURJFZIMRPCZ-SNHBFGBXSA-N | | SMILES | Cl.Cl.NCCCCC(N)[13C](O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-Lysine-1-13C dihydrochloride Usage And Synthesis |
| | DL-Lysine-1-13C dihydrochloride Preparation Products And Raw materials |
|