| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:DL-Lysine-1-13C dihydrochloride CAS:202326-50-9
|
| Company Name: |
Cambridge Isotope Laboratories, Inc.
|
| Tel: |
978 749-8000 |
| Email: |
cilsales@isotope.com |
| Products Intro: |
Product Name:DL-LYSINE:2HCL (2-13C, 99%; EPSILON-15N, 99%) CAS:202326-50-9 Purity:98%
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | DL-LYSINE-1-13C DIHYDROCHLORIDE Basic information |
| | DL-LYSINE-1-13C DIHYDROCHLORIDE Chemical Properties |
| Melting point | 190 °C(lit.) | | form | solid | | InChI | 1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/i6+1;; | | InChIKey | JBBURJFZIMRPCZ-SNHBFGBXSA-N | | SMILES | Cl.Cl.NCCCCC(N)[13C](O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-LYSINE-1-13C DIHYDROCHLORIDE Usage And Synthesis |
| | DL-LYSINE-1-13C DIHYDROCHLORIDE Preparation Products And Raw materials |
|