| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Methyl-5-nitrobenzothiazole Basic information |
| | 2-Methyl-5-nitrobenzothiazole Chemical Properties |
| Melting point | 134-137 °C (lit.) | | Boiling point | 336.5±15.0 °C(Predicted) | | density | 1.445±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -0.07±0.10(Predicted) | | InChI | 1S/C8H6N2O2S/c1-5-9-7-4-6(10(11)12)2-3-8(7)13-5/h2-4H,1H3 | | InChIKey | VEWGTWPJKSPGCD-UHFFFAOYSA-N | | SMILES | Cc1nc2cc(ccc2s1)[N+]([O-])=O | | EPA Substance Registry System | Benzothiazole, 2-methyl-5-nitro- (2941-66-4) |
| Risk Statements | 23/24/25-33 | | Safety Statements | 36/37-45 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2934208090 | | Storage Class | 11 - Combustible Solids |
| | 2-Methyl-5-nitrobenzothiazole Usage And Synthesis |
| Uses | 2-Methyl-5-nitro-1,3-benzothiazole can be used as a amide coupling reagent. | | Synthesis Reference(s) | Synthesis, p. 730, 1976 DOI: 10.1055/s-1976-24175 | | Synthesis | 2-Methyl-5-nitrobenzothiazole can be obtained by first preparing N-(2-bromo-5-nitrophenyl)-acetamide from 2-bromo-5-nitroaniline and then ring-closing. |
| | 2-Methyl-5-nitrobenzothiazole Preparation Products And Raw materials |
|