| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:4-Adamantan-1-ylthiazol-2-ylamine
CAS:19735-74-1
Purity:95% Package:1g
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:4-(1-AdaMantyl)-2-aMinothiazole, 97%
CAS:19735-74-1
Package:250Mg Remarks:H52214
|
|
| | 4-(1-ADAMANTYL)-2-AMINOTHIAZOLE Basic information |
| | 4-(1-ADAMANTYL)-2-AMINOTHIAZOLE Chemical Properties |
| Melting point | 215-215.5 °C(Solv: ethyl acetate (141-78-6)) | | Boiling point | 390.9±11.0 °C(Predicted) | | density | 1.278±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml; DMF:PBS (pH 7) (1:10): 0.1 mg/ml; DMSO: 20 mg/ml; Ethanol: 10 mg/ml | | form | A crystalline solid | | pka | 5.16±0.10(Predicted) | | Sensitive | Air Sensitive | | InChI | 1S/C13H18N2S/c14-12-15-11(7-16-12)13-4-8-1-9(5-13)3-10(2-8)6-13/h7-10H,1-6H2,(H2,14,15) | | InChIKey | JVJWJUQLRDIVJV-UHFFFAOYSA-N | | SMILES | Nc1nc(cs1)C23CC4CC(CC(C4)C2)C3 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 4-(1-ADAMANTYL)-2-AMINOTHIAZOLE Usage And Synthesis |
| Description | 2-amino-4-(1-adamantyl)-Thiazole is a synthetic intermediate useful for pharmaceutical synthesis. | | Uses | 2-Amino-4-(1-adamantyl)thiazole is a synthetic intermediate useful for pharmaceutical synthesis. |
| | 4-(1-ADAMANTYL)-2-AMINOTHIAZOLE Preparation Products And Raw materials |
|