Bis(tri-n-butyltin)sulfide manufacturers
|
| | Bis(tri-n-butyltin)sulfide Basic information |
| | Bis(tri-n-butyltin)sulfide Chemical Properties |
| Boiling point | 208°C 1mm | | density | 1,518 g/cm3 | | refractive index | 1.518 | | Fp | >110℃ | | form | liquid | | color | colorless | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/6C4H9.S.2Sn/c6*1-3-4-2;;;/h6*1,3-4H2,2H3;;; | | InChIKey | BDIWFCKBPZPBQT-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)S[Sn](CCCC)(CCCC)CCCC | | EPA Substance Registry System | Bis(tributyltin) sulfide (4808-30-4) |
| Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 2788 | | WGK Germany | 3 | | RTECS | JN8830000 | | TSCA | TSCA listed | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | Bis(tri-n-butyltin)sulfide Usage And Synthesis |
| Chemical Properties | Colorless oil. | | Uses | Drug. | | Hazard | Moderately toxic by ingestion. |
| | Bis(tri-n-butyltin)sulfide Preparation Products And Raw materials |
|