- Ritodrine hydrochloride
-
- $1.10
-
2025-06-25
- CAS:23239-51-2
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
|
| | Ritodrine hydrochloride Basic information |
| Product Name: | Ritodrine hydrochloride | | Synonyms: | Benzenemethanol, 4-hydroxy-a-[(1R)-1-[[2-(4-hydroxyphenyl)ethyl]amino]ethyl]-, hydrochloride, (aS)-rel- (9CI);Benzenemethanol, 4-hydroxy-a-[1-[[2-(4-hydroxyphenyl)ethyl]amino]ethyl]-, hydrochloride, (R*,S*)-;Benzyl alcohol, p-hydroxy-a-[1-[(p-hydroxyphenethyl)amino]ethyl]-, hydrochloride, erythro- (8CI);NSC 291565;Utemerin;Yutopar;(R*,S*)-4-Hydroxy-alpha-[1-[[2-(4-hydroxyphenyl)ethyl]amino]ethyl]benzyl alcohol hydrochloride;BENZENEMETHANOL,4-HYDROXY-A-[(1R)-1-[[2-(4-HYDROXYPHENYL)ETHYL]AMINO]ETHYL]-,HYDROCHLORIDE | | CAS: | 23239-51-2 | | MF: | C17H22ClNO3 | | MW: | 323.82 | | EINECS: | 245-514-8 | | Product Categories: | RIDZOL;API;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 23239-51-2.mol |  |
| | Ritodrine hydrochloride Chemical Properties |
| Melting point | 192-196°C | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | λmax | 284nm(MeOH)(lit.) | | Merck | 14,8237 | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1/C17H21NO3.ClH/c1-12(17(21)14-4-8-16(20)9-5-14)18-11-10-13-2-6-15(19)7-3-13;/h2-9,12,17-21H,10-11H2,1H3;1H/t12-,17-;/s3 | | InChIKey | IDLSITKDRVDKRV-TYIRTQGFNA-N | | SMILES | C1(C=CC(O)=CC=1)[C@@H](O)[C@H](C)NCCC1=CC=C(O)C=C1.Cl |&1:7,9,r| |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | DO6524000 | | HS Code | 2922504500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | dog,LD50,intravenous,128mg/kg (128mg/kg),LUNGS, THORAX, OR RESPIRATION: DYSPNEABEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLDSENSE ORGANS AND SPECIAL SENSES: MYDRIASIS (PUPILLARY DILATION): EYE,Kiso to Rinsho. Clinical Report. Vol. 18, Pg. 5704, 1984. |
| | Ritodrine hydrochloride Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A β2-Adrenergic agonist. | | Uses | antiprotozoal | | Uses | Tocolytic | | Uses | A -Adrenergic agonist | | Definition | ChEBI: Ritodrine hydrochloride is a primary amine. | | Brand name | Yutopar (AstraZeneca). | | General Description | Ritodrine Hydrochloride is a potent tocolytic drug and a selective γ2-adrenoceptor agonist, widely used for the control of premature labor. |
| | Ritodrine hydrochloride Preparation Products And Raw materials |
|