| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Diethyl trans-4-cyclohexene-1,2-dicarboxylate Basic information |
| Product Name: | Diethyl trans-4-cyclohexene-1,2-dicarboxylate | | Synonyms: | TRANS-1,2,3,6-TETRAHYDROPHTHALIC ACID DIETHYL ESTER;TRANS-4-CYCLOHEXENE-1,2-DICARBOXYLIC ACID DIETHYL ESTER;DIETHYL TRANS-1,2,3,6-TETRAHYDROPHTHALATE;trans-4-Cyclohexene-1,2-dicarboxylic Acid Diethyl Ester
Diethyl trans-1,2,3,6-Tetrahydrophthalate
trans-1,2,3,6-Tetrahydrophthalic Acid Diethyl Ester;Diethyl trans-4-Cyclohexene-1,2-dicarboxylate;trans-Diethyl cyclohex-4-ene-1,2-dicarboxylate;Diethyltrans-4-Cyclohexene-1,2-dicarboxylate>;4-Cyclohexene-1,2-dicarboxylic acid, 1,2-diethyl ester, (1R,2R)-rel- | | CAS: | 5048-50-0 | | MF: | C12H18O4 | | MW: | 226.27 | | EINECS: | | | Product Categories: | | | Mol File: | 5048-50-0.mol |  |
| | Diethyl trans-4-cyclohexene-1,2-dicarboxylate Chemical Properties |
| Boiling point | 160-161 °C(Press: 20 Torr) | | density | 1.064 | | refractive index | 1.4560-1.4600 | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | InChI | 1S/C12H18O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-6,9-10H,3-4,7-8H2,1-2H3/t9-,10-/m1/s1 | | InChIKey | OWVOHDKOANTMJU-NXEZZACHSA-N | | SMILES | CCOC(=O)[C@@H]1CC=CC[C@H]1C(=O)OCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29172090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Diethyl trans-4-cyclohexene-1,2-dicarboxylate Usage And Synthesis |
| Chemical Properties | Colorless liquid |
| | Diethyl trans-4-cyclohexene-1,2-dicarboxylate Preparation Products And Raw materials |
|