|
|
| | 1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene] Basic information |
| Product Name: | 1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene] | | Synonyms: | 1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene];Silane, tetrakis(4-bromophenyl)-;Benzene, 1,1',1'',1'''-silanetetrayltetrakis[4-bromo-;1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene;1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene] - [T93988];tetra(4-bromophenyl)siliconalkane | | CAS: | 18733-98-7 | | MF: | C24H16Br4Si | | MW: | 652.09 | | EINECS: | | | Product Categories: | | | Mol File: | 18733-98-7.mol | ![1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene] Structure](CAS/20180703/GIF/18733-98-7.gif) |
| | 1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene] Chemical Properties |
| Melting point | 240-241 °C(Solv: chloroform (67-66-3); ethanol (64-17-5)) | | Boiling point | 554.4±50.0 °C(Predicted) | | density | 1.83±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder | | color | white | | InChI | 1S/C24H16Br4Si/c25-17-1-9-21(10-2-17)29(22-11-3-18(26)4-12-22,23-13-5-19(27)6-14-23)24-15-7-20(28)8-16-24/h1-16H | | InChIKey | VHVUXJWGYUSRIA-UHFFFAOYSA-N | | SMILES | [Si](c4ccc(cc4)Br)(c3ccc(cc3)Br)(c2ccc(cc2)Br)c1ccc(cc1)Br |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene] Usage And Synthesis |
| Uses | Tetrakis(bromophenyl) silane is an intermediate for emerging hole transport materials based on a silicon core. Materials containing this core have been shown to compete with SpiroMeOTAD for efficiency and stability in perovskite solar cells. |
| | 1,1',1'',1'''-Silanetetrayltetrakis[4-bromobenzene] Preparation Products And Raw materials |
|