| Company Name: |
jiliang chemicals
|
| Tel: |
21-62165282 15801962796; |
| Email: |
bidingchem@163.com |
| Products Intro: |
CAS:18368-91-7
Package:50g
|
| Company Name: |
Shanghai T&W Pharmaceutical Co., Ltd.
|
| Tel: |
+86 21 61551611 |
| Email: |
|
| Products Intro: |
Product Name:2-ETHYLFENCHOL
CAS:18368-91-7
Purity:98% Package:50kg;25kg;10kg;5kg;500g;500mg;
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-ethyl fenchol
CAS:18368-91-7
|
2-ETHYLFENCHOL manufacturers
- 2-Ethylfenchol
-
- $0.00 / 100G
-
2020-02-26
- CAS: 18368-91-7
- Min. Order: 100G
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | 2-ETHYLFENCHOL Basic information |
| | 2-ETHYLFENCHOL Chemical Properties |
| Boiling point | 105 °C15 mm Hg(lit.) | | density | 0.956 g/mL at 25 °C(lit.) | | FEMA | 3491 | 2-ETHYL-1,3,3-TRIMETHYL-2-NORBORNANOL | | refractive index | n20/D 1.482(lit.) | | Fp | 192 °F | | pka | 15.44±0.60(Predicted) | | Odor | at 1.00 % in dipropylene glycol. earthy ground rooty damp musty camphor | | Odor Type | earthy | | Optical Rotation | [α]20/D 12°, c = 1.5 in ethanol | | biological source | synthetic | | JECFA Number | 440 | | BRN | 3044187 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C12H22O/c1-5-12(13)10(2,3)9-6-7-11(12,4)8-9/h9,13H,5-8H2,1-4H3/t9-,11+,12?/m1/s1 | | InChIKey | KIPCKEJKGCXRGA-BVAQLPTGSA-N | | SMILES | CCC1(O)C(C)(C)[C@@H]2CC[C@@]1(C)C2 | | LogP | 3.78 | | EPA Substance Registry System | Bicyclo[2.2.1]heptan-2-ol, 2-ethyl-1,3,3-trimethyl- (18368-91-7) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | 2-ETHYLFENCHOL Usage And Synthesis |
| Chemical Properties | Off-white to light yellow liquid with a characteristic odor of pungent camphor and earth. Soluble in ethanol, propylene glycol and most fixed oils, insoluble in water. | | Uses | flavors and fragrances | | Aroma threshold values | Aroma characteristics at 1.0%: camphor cooling, citrus lime-like, fruity blueberry. | | Taste threshold values | Taste characteristics at 10 ppm: camphor-like cooling, citrus and fresh. | | Biological Activity | Taste at 10 ppm |
| | 2-ETHYLFENCHOL Preparation Products And Raw materials |
|