|
|
| | 7-Diethylamino-3-(4'-maleimidylphenyl)-4- methylcoumarin Basic information |
| Product Name: | 7-Diethylamino-3-(4'-maleimidylphenyl)-4- methylcoumarin | | Synonyms: | AURORA KA-6719;7-DIETHYLAMINO-3-(4-MALEIMIDOPHENYL)-4-METHYLCOUMARIN;7-DIETHYLAMINO-3-(4'-MALEIMIDYLPHENYL)-4-METHYLCOUMARIN;7-DIETHYLAMINO-3-(4-MALEIMIODOPHENYL)-4-METHYLCOUMARIN;1H-PYRROLE-2,5-DIONE, 1-(4-(7-(DIETHYLAMINO)-4-METHYL-2-OXO-2H-1-BENZOPYRAN-3-YL)PHENYL)-;1-[4-(7-Diethylamino-4-methyl-2-oxo-2H-chromen-3-yl)-phenyl]-pyrrole-2,5-dione;7-Diethylamino-3-(4-maleimidophenyl)-4-methylcumarin;n-(4-(7-diethylamino-4-methylcoumarin-3-yl)phenyl)maleimide | | CAS: | 76877-33-3 | | MF: | C24H22N2O4 | | MW: | 402.44 | | EINECS: | | | Product Categories: | Coumarines | | Mol File: | 76877-33-3.mol |  |
| | 7-Diethylamino-3-(4'-maleimidylphenyl)-4- methylcoumarin Chemical Properties |
| Melting point | 220-223°C | | Boiling point | 618.7±55.0 °C(Predicted) | | density | 1.302±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble | | pka | 3.28±0.20(Predicted) | | form | solid | | color | yellow | | Appearance | Yellow to Dark Orange Solid | | biological source | rabbit | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C24H22N2O4/c1-4-25(5-2)18-10-11-19-15(3)23(24(29)30-20(19)14-18)16-6-8-17(9-7-16)26-21(27)12-13-22(26)28/h6-14H,4-5H2,1-3H3 | | InChIKey | YGIABALXNBVHBX-UHFFFAOYSA-N | | SMILES | CCN(CC)c1ccc2C(C)=C(C(=O)Oc2c1)c3ccc(cc3)N4C(=O)C=CC4=O |
| WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | 7-Diethylamino-3-(4'-maleimidylphenyl)-4- methylcoumarin Usage And Synthesis |
| Description | 7-Diethylamino-3-(4-maleimidophenyl)-4-methylcoumarin is a thiol-reactive fluorescent probe. It displays excitation/emission maxima of 387/468 nm, respectively, and fluorescence intensity increases when bound to cysteine residues. | | Uses | (7-Diethylamino-3-(4'-maleimidylphenyl)-4- methylcoumarin)CPM is probably the most widely used blue fluorescent thiol-reactive dye. This maleimide derivative of coumarin is essentially nonfluorescent until it reacts with thiols, making it possible to quantify thiols without a separation step. CPM is a good energ | | Uses | 7-Diethylamino-3-(4-maleimidophenyl)-4-methylcoumarin is a thiol-reactive fluorescent probe. 7-Diethylamino-3-(4-maleimidophenyl)-4-methylcoumarin (CPM) is a thiol-reactive fluorescent probe. CPM selectively forms Michael adducts in the presence of hyperreactive sulfhydryls. CPM has been used to monitor the release of thiols, quantitate thiol in microplate reactions, and to distinguish proliferating cancer cells by nucleolar protein staining. Dyes and metabolites. | | References | [1] SIPPEL T O. New fluorochromes for thiols: maleimide and iodoacetamide derivatives of a 3-phenylcoumarin fluorophore.[J]. Journal of Histochemistry & Cytochemistry, 1981, 29 2: 314-316. DOI: 10.1177/29.2.7019305
[2] RAYMOND F. CHEN C S. Atlas of Fluorescence Spectra and Lifetimes of Dyes Attached to Protein[J]. Analytical Letters, 1985, 18 1: 393-421. DOI: 10.1080/00032718508066142
[3] GEETIKA AGGARWAL. Symmetrically substituted dichlorophenes inhibit N-acyl-phosphatidylethanolamine phospholipase D[J]. The Journal of Biological Chemistry, 2020, 33 1: 7289-7300. DOI: 10.1101/2020.03.05.979567 | | Excitation / Emission Maximum | 387 nm/468 nm |
| | 7-Diethylamino-3-(4'-maleimidylphenyl)-4- methylcoumarin Preparation Products And Raw materials |
|