|
|
| | Ethyl 2-(hydroxyimino)-3-oxobutanoate Basic information |
| Product Name: | Ethyl 2-(hydroxyimino)-3-oxobutanoate | | Synonyms: | Ethyl2-(hydroxyimino)acetoacetate;OXIMINOACETOACETIC ESTER;AURORA KA-158;ethyl (2E)-2-(hydroxyimino)-3-oxobutanoate;Butyric acid, 2,3-dioxo-, ethyl ester, 2-oxiMe (6CI,7CI,8CI);Butyric acid, α,β-dioxo-, ethyl ester α-oxiMe (4CI);NSC 10758;(2E)-2-hydroximino-3-keto-butyric acid ethyl ester | | CAS: | 5408-04-8 | | MF: | C6H9NO4 | | MW: | 159.14 | | EINECS: | | | Product Categories: | | | Mol File: | 5408-04-8.mol |  |
| | Ethyl 2-(hydroxyimino)-3-oxobutanoate Chemical Properties |
| Melting point | 46-48°C | | Boiling point | 136-137 °C(Press: 5 Torr) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 7.41±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C6H9NO4/c1-3-11-6(9)5(7-10)4(2)8/h10H,3H2,1-2H3 | | InChIKey | IACSYDRIOYGJNH-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(=NO)C(=O)C |
| HazardClass | IRRITANT | | HS Code | 2923900090 |
| | Ethyl 2-(hydroxyimino)-3-oxobutanoate Usage And Synthesis |
| Uses | Ethyl-2-(hydroxyimino)-3-oxobutanoate (cas# 5408-04-8) is a compound useful in organic synthesis. |
| | Ethyl 2-(hydroxyimino)-3-oxobutanoate Preparation Products And Raw materials |
|