1,2,3-TRIAZOLO(1,5-A)PYRIDINE manufacturers
|
| | 1,2,3-TRIAZOLO(1,5-A)PYRIDINE Basic information |
| | 1,2,3-TRIAZOLO(1,5-A)PYRIDINE Chemical Properties |
| Melting point | 39-40 C | | Boiling point | 106-109 °C(Press: 0.6 Torr) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 1.17±0.30(Predicted) | | Appearance | Brown to dark brown Liquid | | InChI | InChI=1S/C6H5N3/c1-2-4-9-6(3-1)5-7-8-9/h1-5H | | InChIKey | AQWOIRBQLOOZGX-UHFFFAOYSA-N | | SMILES | C12=CN=NN1C=CC=C2 |
| | 1,2,3-TRIAZOLO(1,5-A)PYRIDINE Usage And Synthesis |
| | 1,2,3-TRIAZOLO(1,5-A)PYRIDINE Preparation Products And Raw materials |
|