|
|
| | 1-(tert-butyl) 2-methyl (R)-4-oxopiperidine-1,2-dicarboxylate Basic information |
| Product Name: | 1-(tert-butyl) 2-methyl (R)-4-oxopiperidine-1,2-dicarboxylate | | Synonyms: | 1-(tert-butyl) 2-methyl (R)-4-oxopiperidine-1,2-dicarboxylate;1,2-Piperidinedicarboxylic acid, 4-oxo-, 1-(1,1-dimethylethyl) 2-methyl ester, (2R)-;1-O-tert-butyl 2-O-methyl (2R)-4-oxopiperidine-1,2-dicarboxylate;Methyl (R)-1-Boc-4-oxopiperidine-2-carboxylate;1-tert-Butyl2-methyl(2R)-4-oxopiperidine-1,2-dicarboxylate;Methyl (2R)-4-oxopiperidine-2-carboxylate, N-BOC protected | | CAS: | 1799811-83-8 | | MF: | C12H19NO5 | | MW: | 257.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1799811-83-8.mol |  |
| | 1-(tert-butyl) 2-methyl (R)-4-oxopiperidine-1,2-dicarboxylate Chemical Properties |
| Boiling point | 350.0±42.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.59±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H19NO5/c1-12(2,3)18-11(16)13-6-5-8(14)7-9(13)10(15)17-4/h9H,5-7H2,1-4H3/t9-/m1/s1 | | InChIKey | ROHLQPZIUYTLGR-SECBINFHSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C[C@@H]1C(OC)=O |
| | 1-(tert-butyl) 2-methyl (R)-4-oxopiperidine-1,2-dicarboxylate Usage And Synthesis |
| | 1-(tert-butyl) 2-methyl (R)-4-oxopiperidine-1,2-dicarboxylate Preparation Products And Raw materials |
|