|
|
| | (N,N-Diethyl-3-aminopropyl)trimethoxysilane Basic information |
| Product Name: | (N,N-Diethyl-3-aminopropyl)trimethoxysilane | | Synonyms: | (3-DIETHYLAMINOPROPYL)TRIMETHOXYSILANE;3-(N,N-DIETHYLAMINO)PROPYLTRIMETHOXYSILANE;(N,N-DIETHYL-3-AMINOPROPYL)TRIMETHOXYSILANE;N,N-DIETHYL-3-(TRIMETHOXYSILYL)PROPYLAMINE;N,N-DIETHYL-3-(TRIMETHOXYSILYL)-1-PROPANAMIN;(Trimethoxysilylpropyl)diethylamine;Diethylaminopropyltrimethoxysilane;N-ethyl-N-(trimethoxysilylpropyl)ethanamine | | CAS: | 41051-80-3 | | MF: | C10H25NO3Si | | MW: | 235.4 | | EINECS: | 255-192-0 | | Product Categories: | Amino Silanes;Industrial/Fine Chemicals | | Mol File: | 41051-80-3.mol |  |
| | (N,N-Diethyl-3-aminopropyl)trimethoxysilane Chemical Properties |
| Boiling point | 120 °C/20 mmHg (lit.) | | density | 0.95 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.423(lit.) | | Fp | 212 °F | | storage temp. | 2-8°C | | form | liquid | | pka | 10.56±0.25(Predicted) | | Specific Gravity | 0.934 | | color | Colorless to Yellow | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C10H25NO3Si/c1-6-11(7-2)9-8-10-15(12-3,13-4)14-5/h6-10H2,1-5H3 | | InChIKey | ZLDHYRXZZNDOKU-UHFFFAOYSA-N | | SMILES | C(N(CC)CC)CC[Si](OC)(OC)OC | | CAS DataBase Reference | 41051-80-3(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanamine, N,N-diethyl-3-(trimethoxysilyl)- (41051-80-3) |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | (N,N-Diethyl-3-aminopropyl)trimethoxysilane Usage And Synthesis |
| Chemical Properties | Yellowish clear liquid with amine odor | | Uses | [3-(Diethylamino)propyl]trimethoxysilane was covalently bonded to mesoporous titania–silica mixed oxides to act as epoxidation catalysts.{55} [3-(Diethylamino)propyl]trimethoxysilane, immobilized on mesoporous silicas (SBA-15) may be used as adsorbents to capture CO2. {56} |
| | (N,N-Diethyl-3-aminopropyl)trimethoxysilane Preparation Products And Raw materials |
|