|
|
| | ZK756326(dihydrochloride) Basic information |
| | ZK756326(dihydrochloride) Chemical Properties |
| storage temp. | Store at -20°C | | solubility | PBS (pH 7.2): 10 mg/ml | | form | A crystalline solid | | color | White to off-white | | InChI | InChI=1S/C21H28N2O3.ClH/c24-14-16-25-15-13-22-9-11-23(12-10-22)18-19-5-4-8-21(17-19)26-20-6-2-1-3-7-20;/h1-8,17,24H,9-16,18H2;1H | | InChIKey | GPPMZVONOXAYET-UHFFFAOYSA-N | | SMILES | C(N1CCN(CCOCCO)CC1)C1C=CC=C(OC2C=CC=CC=2)C=1.Cl |
| | ZK756326(dihydrochloride) Usage And Synthesis |
| Uses | ZK756326 dihydrochloride is a nonpeptide chemokine receptor agonist for the CC chemokine receptor CCR8. | | IC 50 | CCR8: 1.8 μM (IC50, in U87 cells); 5-HT2B: 4.4 μM (IC50); 5-HT1A: 5.4 μM (IC50); 5-HT6: 5.9 μM (IC50); 5-HT5A: 16 μM (IC50); 5-HT2C: 34.8 μM (IC50); α2A: <20 μM (IC50) | | References | [1] Haskell CA, et al. Identification and characterization of a potent, selective nonpeptide agonist of the CC chemokine receptor CCR8. Mol Pharmacol. 2006 Jan;69(1):309-16. DOI:10.1124/mol.105.014779 |
| | ZK756326(dihydrochloride) Preparation Products And Raw materials |
|