Pomalidomide Impurity 10 manufacturers
|
| | Pomalidomide Impurity 10 Basic information |
| Product Name: | Pomalidomide Impurity 10 | | Synonyms: | 3-(amino-1,3-dioxoisoindolin-2-yl)-phthalic acid;Pomalidomide Impurity;3-(3-Aminophthalimido)-phthalic acid;3-(4-amino-1,3-dioxoisoindolin-2-yl)phthalic acid;1,2-Benzenedicarboxylic acid, 3-(4-amino-1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-;Pomadomide impurity 5;Pomalidomide Impurity 1（Apremilast Impurity 56） | | CAS: | 92792-46-6 | | MF: | C16H10N2O6 | | MW: | 326.26 | | EINECS: | | | Product Categories: | | | Mol File: | 92792-46-6.mol |  |
| | Pomalidomide Impurity 10 Chemical Properties |
| Boiling point | 667.2±65.0 °C(Predicted) | | density | 1.680±0.06 g/cm3(Predicted) | | pka | 2.56±0.36(Predicted) | | InChI | InChI=1S/C16H10N2O6/c17-9-5-1-3-7-11(9)14(20)18(13(7)19)10-6-2-4-8(15(21)22)12(10)16(23)24/h1-6H,17H2,(H,21,22)(H,23,24) | | InChIKey | IKAXVAGBGPKCSW-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=CC=CC(N2C(=O)C3=C(C2=O)C=CC=C3N)=C1C(O)=O |
| | Pomalidomide Impurity 10 Usage And Synthesis |
| | Pomalidomide Impurity 10 Preparation Products And Raw materials |
|