di-n-butyl naphthalene-2,6-dicarboxylate manufacturers
|
| | di-n-butyl naphthalene-2,6-dicarboxylate Basic information |
| Product Name: | di-n-butyl naphthalene-2,6-dicarboxylate | | Synonyms: | di-n-butyl naphthalene-2,6-dicarboxylate;dibutyl naphthalene-2,6-dicarboxylate;2,6-Naphthalenedicarboxylic acid, 2,6-dibutyl ester;Dibutyl napththalene-2,6-dicarboxylate;naphthalene-2,6-dicarboxylic acid dibutyl ester | | CAS: | 94686-82-5 | | MF: | C20H24O4 | | MW: | 328.4 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 94686-82-5.mol |  |
| | di-n-butyl naphthalene-2,6-dicarboxylate Chemical Properties |
| Boiling point | 220-230 °C(Press: 0.2 Torr) | | density | 1.100±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C20H24O4/c1-3-5-11-23-19(21)17-9-7-16-14-18(10-8-15(16)13-17)20(22)24-12-6-4-2/h7-10,13-14H,3-6,11-12H2,1-2H3 | | InChIKey | PCFNKFGGJYQMTR-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(C(OCCCC)=O)C=C2)=CC=C1C(OCCCC)=O |
| | di-n-butyl naphthalene-2,6-dicarboxylate Usage And Synthesis |
| | di-n-butyl naphthalene-2,6-dicarboxylate Preparation Products And Raw materials |
|