| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Pentafluorophenylmagnesium bromide Basic information |
| Product Name: | Pentafluorophenylmagnesium bromide | | Synonyms: | pentafluorophenylmagnesium bromide sol.;Pentafluorophenylmagnesium bromide solution;PENTAFLUOROPHENYLMAGNESIUM BROMIDE, 0.5M SOLUTION IN DIETHYL ETHER;PENTAFLUOROPHENYLMAGNESIUM BROMIDE SOL., ~0.5 M IN DIETHYL ET;PENTAFLUOROPHENYLMAGNESIUM BROMIDE SOL. TECH ABOUT 0.5 M IN DIETHYL ET;sol.techabout0.5mindiethylet;Magnesium, bromo(pentafluorophenyl)-;Pentafluorophenylmagnesium bromide solution 0.5 in diethyl ether | | CAS: | 879-05-0 | | MF: | C6BrF5Mg | | MW: | 271.27 | | EINECS: | | | Product Categories: | Aryl;Grignard Reagents;Organometallic Reagents | | Mol File: | 879-05-0.mol |  |
| | Pentafluorophenylmagnesium bromide Chemical Properties |
| Boiling point | 34.6 °C | | density | 0.861 g/mL at 25 °C | | Fp | −35 °F | | form | liquid | | BRN | 3611565 | | InChI | 1S/C6F5.BrH.Mg/c7-2-1-3(8)5(10)6(11)4(2)9;;/h;1H;/q;;+1/p-1 | | InChIKey | AXQVMJIDNDRSFM-UHFFFAOYSA-M | | SMILES | Fc1c(F)c(F)c([Mg]Br)c(F)c1F | | EPA Substance Registry System | Magnesium, bromo(pentafluorophenyl)- (879-05-0) |
| Hazard Codes | F+,C | | Risk Statements | 12-14-19-22-34-66-67 | | Safety Statements | 26-36/37/39-43-45-16 | | RIDADR | UN 2924 3/PG 1 | | WGK Germany | 1 | | F | 1-3-10 | | TSCA | TSCA listed | | HazardClass | 3, 8 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 1
Skin Corr. 1B
STOT SE 3 |
| | Pentafluorophenylmagnesium bromide Usage And Synthesis |
| Uses | Employed in the synthesis of novel arsonic and arsinic acids as ligands for potential transition-metal ion extractants, and in the synthesis of polyfluoroaryl alkyl sulfides. | | reaction suitability | reaction type: Grignard Reaction |
| | Pentafluorophenylmagnesium bromide Preparation Products And Raw materials |
|