| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | S(-)-ihmb hydrochloride Basic information |
| Product Name: | S(-)-ihmb hydrochloride | | Synonyms: | S(-)-SCH-23388, IODO ANALOG HYDROCHLORIDE;S(-)-IHMB;S(-)-ihmb hydrochloride | | CAS: | | | MF: | C17H19ClINO | | MW: | 415.7 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | S(-)-ihmb hydrochloride Chemical Properties |
| storage temp. | −20°C | | solubility | H2O: soluble | | form | solid | | color | white | | Water Solubility | H2O: soluble | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H18INO.ClH/c1-19-8-7-13-9-16(18)17(20)10-14(13)15(11-19)12-5-3-2-4-6-12;/h2-6,9-10,15,20H,7-8,11H2,1H3;1H/t15-;/m0./s1 | | InChIKey | DFQHTWDGSWQAGQ-RSAXXLAASA-N | | SMILES | Cl.CN1CCc2cc(I)c(O)cc2[C@@H](C1)c3ccccc3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | S(-)-ihmb hydrochloride Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. | | Biological Activity | Less active enantiomer of R(+)-SCH-23390 iodo analog. |
| | S(-)-ihmb hydrochloride Preparation Products And Raw materials |
|