|
|
| | 5-Methylisophthalic acid Basic information |
| | 5-Methylisophthalic acid Chemical Properties |
| Melting point | 299-303 °C(lit.) | | Boiling point | 408.7±33.0 °C(Predicted) | | density | 1.377±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.60±0.10(Predicted) | | color | White to Light yellow to Green | | InChI | InChI=1S/C9H8O4/c1-5-2-6(8(10)11)4-7(3-5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) | | InChIKey | PMZBHPUNQNKBOA-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=CC(C)=CC(C(O)=O)=C1 | | CAS DataBase Reference | 499-49-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Methylisophthalic acid Usage And Synthesis |
| Chemical Properties | Solid | | Uses | 5-Methylisophthalic acid can be used in the synthesis of a La(III)–Co(II) heterometallic framework via reaction with lanthanum(III)chloride hydrate and cobalt(II)acetate under ionothermal conditions. |
| | 5-Methylisophthalic acid Preparation Products And Raw materials |
|