| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-(Trifluoromethoxy)thiobenzamide Basic information |
| Product Name: | 4-(Trifluoromethoxy)thiobenzamide | | Synonyms: | 4-(trifluoromethoxy)benzene-1-carbothioamide;BUTTPARK 62\07-45;4-(Trifluoromethoxy)thiobenzamide 97%;4-(Trifluoromethoxy)thiobenzamide97%;4-(TRIFLUOROMETHOXY)BENZENECARBOTHIOAMIDE;4-(Trifluoromethoxy)benzothioamide;4-(Trifluoromethoxyl)thiobenzamide;Benzenecarbothioamide,4-(trifluoromethoxy)- | | CAS: | 149169-34-6 | | MF: | C8H6F3NOS | | MW: | 221.2 | | EINECS: | | | Product Categories: | | | Mol File: | 149169-34-6.mol |  |
| | 4-(Trifluoromethoxy)thiobenzamide Chemical Properties |
| Melting point | 124-126°C | | form | solid | | color | Beige | | InChI | 1S/C8H6F3NOS/c9-8(10,11)13-6-3-1-5(2-4-6)7(12)14/h1-4H,(H2,12,14) | | InChIKey | GHQSKHMIUWHKHO-UHFFFAOYSA-N | | SMILES | FC(F)(F)Oc1ccc(cc1)C(=S)N |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-43-22 | | Safety Statements | 26-36/37/39-36/37 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2930909899 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | 4-(Trifluoromethoxy)thiobenzamide Usage And Synthesis |
| | 4-(Trifluoromethoxy)thiobenzamide Preparation Products And Raw materials |
|