| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
|
| | N-((1E,3E)-3-(phenylimino)prop-1-en-1-yl)aniline hydrochloride Basic information |
| Product Name: | N-((1E,3E)-3-(phenylimino)prop-1-en-1-yl)aniline hydrochloride | | Synonyms: | N-((1E,3E)-3-(phenylimino)prop-1-en-1-yl)aniline hydrochloride;N-[3-(phenylamino)-2-propen-1-ylidene]-benzenamine hydrochloride (1:1);(E)-N-((E)-3-(Phenylamino)allylidene)aniline hydrochloride;(N-((1E,3E)-3-(phenylimino)prop-1-en-1-yl)aniline HCl salt);(E,E)-N-[3-(phenylamino)-2-propenylidene]benzenaminehydrochloride;N-(3-(PHENYLAMINO)-2-PROPENYLIDENE)ANILINE HYDROCHLORIDE | | CAS: | 58467-94-0 | | MF: | C15H14N2.ClH | | MW: | 258.75 | | EINECS: | | | Product Categories: | | | Mol File: | 58467-94-0.mol |  |
| | N-((1E,3E)-3-(phenylimino)prop-1-en-1-yl)aniline hydrochloride Chemical Properties |
| Melting point | 156 °C | | storage temp. | Store at room temperature, keep dry and cool | | Appearance | Yellow to orange Solid | | InChI | InChI=1S/C15H14N2.ClH/c1-3-8-14(9-4-1)16-12-7-13-17-15-10-5-2-6-11-15;/h1-13,16H;1H/b12-7+,17-13+; | | InChIKey | PBKBURVPAHHUIK-LIQLGICFSA-N | | SMILES | N(/C=C/C=N/C1=CC=CC=C1)C1=CC=CC=C1.[H]Cl |
| | N-((1E,3E)-3-(phenylimino)prop-1-en-1-yl)aniline hydrochloride Usage And Synthesis |
| | N-((1E,3E)-3-(phenylimino)prop-1-en-1-yl)aniline hydrochloride Preparation Products And Raw materials |
|