4-tert-Butylcyclohexyl acetic acid manufacturers
|
| | 4-tert-Butylcyclohexyl acetic acid Basic information |
| Product Name: | 4-tert-Butylcyclohexyl acetic acid | | Synonyms: | 4-TERT-BUTYLCYCLOHEXYL ACETIC ACID;SALOR-INT L128406-1EA;Butylcyclohexyl acetic acid;2-[4-(tert-Butyl)cyclohexyl]ethanoic acid, 1-(tert-Butyl)-4-(carboxymethyl)cyclohexane;Cyclohexaneacetic acid, 4-(1,1-dimethylethyl)-;4-TERT-BUTYLCYCLOHEXYL ACETIC ACID ISO 9001：2015 REACH;Selamectin Impurity 9 | | CAS: | 105906-07-8 | | MF: | C12H22O2 | | MW: | 198.3 | | EINECS: | | | Product Categories: | | | Mol File: | 105906-07-8.mol |  |
| | 4-tert-Butylcyclohexyl acetic acid Chemical Properties |
| Melting point | 81-83 °C | | Boiling point | 300.1±10.0 °C(Predicted) | | density | 0.967±0.06 g/cm3(Predicted) | | pka | 4.72±0.10(Predicted) | | InChI | InChI=1S/C12H22O2/c1-12(2,3)10-6-4-9(5-7-10)8-11(13)14/h9-10H,4-8H2,1-3H3,(H,13,14) | | InChIKey | UEERPCZVXPLDMN-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)CCC(C(C)(C)C)CC1 |
| Hazard Codes | Xi | | HS Code | 2916200090 |
| | 4-tert-Butylcyclohexyl acetic acid Usage And Synthesis |
| Uses | 4-Tert-Butylcyclohexyl acetic acid is used primarily in the fragrance industry due to its strong, woody, amber-like scent, serving as a key ingredient in perfumes, soaps, cosmetics, and household cleaning products . Additionally, it functions as a fixative agent in perfume formulations to enhance scent longevity . |
| | 4-tert-Butylcyclohexyl acetic acid Preparation Products And Raw materials |
|