2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE manufacturers
- Methylstenbolone
-
- $1.00 / 1g
-
2026-05-26
- CAS:6176-38-1
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100kg
- Methylstenbolone
-
- $10.00 / 1box
-
2026-05-19
- CAS:6176-38-1
- Min. Order: 1box
- Purity: 99.99%
- Supply Ability: 9999
|
| | 2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE Basic information |
| Product Name: | 2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE | | Synonyms: | 2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE;Nsc74234;Methylstenbolone (1.0mg/ml in Acetonitrile);Androst-1-en-3-one, 17-hydroxy-2,17-dimethyl-, (5α,17β)-;Methyl stenolone;Methylstenbolone 10mg Tablets;Methylstenbolone (1 mg/ml in Acetonitrile);2,17α-dimethyl-5α-androst-1-en-17β-ol-3-one | | CAS: | 6176-38-1 | | MF: | C21H32O2 | | MW: | 316.48 | | EINECS: | | | Product Categories: | | | Mol File: | 6176-38-1.mol |  |
| | 2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE Chemical Properties |
| InChI | InChI=1/C21H32O2/c1-13-12-19(2)14(11-18(13)22)5-6-15-16(19)7-9-20(3)17(15)8-10-21(20,4)23/h12,14-17,23H,5-11H2,1-4H3/t14-,15+,16-,17-,19-,20-,21-/s3 | | InChIKey | TVTSDURKYARCML-MLJIMZIRNA-N | | SMILES | C1C[C@]2([H])[C@]3(C=C(C(C[C@]3([H])CC[C@]2([C@]2([H])CC[C@](C)(O)[C@@]12C)[H])=O)C)C |&1:2,4,9,13,14,18,21,r| |
| | 2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE Usage And Synthesis |
| Uses | Methylstenbolone is an anabolic androgenic steroid that have been studied in respect of testosterone-receptor interaction and in the development of QSAR models. | | Definition | ChEBI: 17beta-Hydroxy-2,17-dimethyl-5alpha-androst-1-en-3-one is a 3-hydroxy steroid. It has a role as an androgen. |
| | 2,17A-DIMETHYL-17BETA-HYDROXY-5A-ANDROST-1-ENE-3-ONE Preparation Products And Raw materials |
|