| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
1H-Indole, 5-bromo-2-phenyl- manufacturers
|
| | 1H-Indole, 5-bromo-2-phenyl- Basic information |
| | 1H-Indole, 5-bromo-2-phenyl- Chemical Properties |
| Melting point | 195-196℃ | | density | 1.484 | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C14H10BrN/c15-12-6-7-13-11(8-12)9-14(16-13)10-4-2-1-3-5-10/h1-9,16H | | InChIKey | XGOWHPSXPPZWAH-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Br)C=C2)C=C1C1=CC=CC=C1 |
| | 1H-Indole, 5-bromo-2-phenyl- Usage And Synthesis |
| | 1H-Indole, 5-bromo-2-phenyl- Preparation Products And Raw materials |
|