| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-[4-(Trifluoromethyl)phenyl]benzaldehyde Basic information |
| Product Name: | 2-[4-(Trifluoromethyl)phenyl]benzaldehyde | | Synonyms: | 4'-(TRIFLUOROMETHYL)-2-BIPHENYLCARBOXALDEHYDE;4'-(TRIFLUOROMETHYL)[1,1'-BIPHENYL]-2-CARBALDEHYDE;4'-(TRIFLUOROMETHYL)[1,1'-BIPHENYL]-2-CARBOXALDEHYDE;4'-TRIFLUOROMETHYL-BIPHENYL-2-CARBALDEHYDE;AKOS BAR-0246;[1,1'-Biphenyl]-2-carboxaldehyde, 4'-(trifluoromethyl)-;4'-(Trifluoromethyl)-[1,1'-biphenyl]-2-carbaldehyde;4'-(Trifluoromethyl)biphenyl-2-carbaldehyde | | CAS: | 84392-23-4 | | MF: | C14H9F3O | | MW: | 250.22 | | EINECS: | | | Product Categories: | | | Mol File: | 84392-23-4.mol | ![2-[4-(Trifluoromethyl)phenyl]benzaldehyde Structure](CAS/GIF/84392-23-4.gif) |
| | 2-[4-(Trifluoromethyl)phenyl]benzaldehyde Chemical Properties |
| Boiling point | 324.6±42.0 °C(Predicted) | | density | 1.273 g/mL at 25 °C | | refractive index | n20/D1.552 | | Fp | >121℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | InChI | 1S/C14H9F3O/c15-14(16,17)12-7-5-10(6-8-12)13-4-2-1-3-11(13)9-18/h1-9H | | InChIKey | UUSBTGUDEHRZTF-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(cc1)-c2ccccc2C=O | | CAS DataBase Reference | 84392-23-4(CAS DataBase Reference) |
| Hazard Codes | Xi,N,Xn | | Risk Statements | 36/37/38-51/53-22 | | Safety Statements | 26-36/37/39-61 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2913000090 | | Storage Class | 13 - Non Combustible Solids |
| | 2-[4-(Trifluoromethyl)phenyl]benzaldehyde Usage And Synthesis |
| Uses | 2-[4-(Trifluoromethyl)Phenyl]Benzaldehyde is a useful reactant for organic reactions. |
| | 2-[4-(Trifluoromethyl)phenyl]benzaldehyde Preparation Products And Raw materials |
|