| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2,3,5,6-Tetrafluoro-4-aminobenzotrifluoride manufacturers
|
| | 2,3,5,6-Tetrafluoro-4-aminobenzotrifluoride Basic information |
| Product Name: | 2,3,5,6-Tetrafluoro-4-aminobenzotrifluoride | | Synonyms: | 4-AMINO-2,3,5,6-TETRAFLUOROBENZOTRIFLUORIDE;4-AMINO-HEPTAFLUOROTOLUENE;AKOS B014369;2,3,5,6,ALPHA,ALPHA,ALPHA-HEPTAFLUORO-P-TOLUIDINE;2,3,5,6,α,α,α-heptafluoro-p-toluidine;4-Amino-heptafluorotoluene,95%;Yu-Wasa Auxiliary
;Yu-Wasa Auxiliary 97% | | CAS: | 651-83-2 | | MF: | C7H2F7N | | MW: | 233.09 | | EINECS: | | | Product Categories: | | | Mol File: | 651-83-2.mol |  |
| | 2,3,5,6-Tetrafluoro-4-aminobenzotrifluoride Chemical Properties |
| Boiling point | 186 °C(lit.) | | density | 1.687 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.431(lit.) | | Fp | 190 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | clear liquid | | pka | -2.05±0.10(Predicted) | | Specific Gravity | 1.680 | | color | Colorless to Light yellow to Light orange | | BRN | 2657893 | | InChI | 1S/C7H2F7N/c8-2-1(7(12,13)14)3(9)5(11)6(15)4(2)10/h15H2 | | InChIKey | FJOACTZFMHZHSC-UHFFFAOYSA-N | | SMILES | Nc1c(F)c(F)c(c(F)c1F)C(F)(F)F | | CAS DataBase Reference | 651-83-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29214300 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,3,5,6-Tetrafluoro-4-aminobenzotrifluoride Usage And Synthesis |
| Chemical Properties | clear colourless to light brown liquid | | reaction suitability | reaction type: C-C Bond Formation
reagent type: catalyst
reaction type: C-H Activation |
| | 2,3,5,6-Tetrafluoro-4-aminobenzotrifluoride Preparation Products And Raw materials |
| Raw materials | Benzenamine, 2,3,5,6-tetrafluoro-N-hydroxy-4-(trifluoromethyl)--->oxido-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-[2,3,5,6-tetrafl uoro-4-(trifluoromethyl)phenyl]imino-azanium-->Benzenamine, 2,3,5,6-tetrafluoro-N-(phenylmethylene)-4-(trifluoromethyl)--->2,3,5,6-Tetrafluoro-4-hydrazinobenzotrifluoride-->Octafluorotoluene-->Benzoic acid | | Preparation Products | Pentafluorobenzoic acid |
|