| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
2',3'-Dimethoxy-3-hydroxyflavone manufacturers
|
| | 2',3'-Dimethoxy-3-hydroxyflavone Basic information |
| Product Name: | 2',3'-Dimethoxy-3-hydroxyflavone | | Synonyms: | 3,3',4'-TRIHYDROXYFLAVONE;2',3'-DIMETHOXYFLAVONOL;4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3-hydroxy-;2-(3,4-Dihydroxyphenyl)-3-hydroxy-4H-1-benzopyran-4-one;3-Hydroxy-2-(3,4-dihydroxyphenyl)-4H-1-benzopyran-4-one;2-(2,3-Dimethoxyphenyl)-3-hydroxy-4H-chromen-4-one, 2-(2,3-Dimethoxyphenyl)-3-hydroxy-4-oxo-4H-chromene;2-(3,4-Dihydroxyphenyl)-3-hydroxy-4H-chromen-4-one;2-(3,4-Dihydroxyphenyl)-3-hydroxy-4H-benzopyran-4-one | | CAS: | 6068-78-6 | | MF: | C15H10O5 | | MW: | 270.24 | | EINECS: | | | Product Categories: | Di-substituted Flavones | | Mol File: | 6068-78-6.mol |  |
| | 2',3'-Dimethoxy-3-hydroxyflavone Chemical Properties |
| Melting point | 301-303 °C (decomp)(Solv: methanol (67-56-1)) | | Boiling point | 508.9±50.0 °C(Predicted) | | density | 1.579±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >15mg/mL | | form | powder | | pka | 8.58±0.20(Predicted) | | color | faint yellow to dark yellow | | Cosmetics Ingredients Functions | ANTIOXIDANT
SKIN CONDITIONING - MISCELLANEOUS | | InChI | 1S/C15H10O5/c16-10-6-5-8(7-11(10)17)15-14(19)13(18)9-3-1-2-4-12(9)20-15/h1-7,16-17,19H | | InChIKey | KPGMHZQXQVDYNT-UHFFFAOYSA-N | | SMILES | Oc1ccc(cc1O)C2=C(O)C(=O)c3ccccc3O2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2',3'-Dimethoxy-3-hydroxyflavone Usage And Synthesis |
| Uses | 3'',4''-Dihydroxyflavonol is a synthetic flavonol shown to be able to significantly improve endothelium-dependent relaxation in the presence of those oxygen radical generators in rats. | | Definition | ChEBI: 3,3',4'-trihydroxyflavone is a hydroxyflavan. | | Biological Activity | 3′,4′-Dihydroxyflavonol is a synthetic cardioprotective flavone th at attenuates myocardial ischemia/reperfusion injury, which associated with its antioxidant activity. |
| | 2',3'-Dimethoxy-3-hydroxyflavone Preparation Products And Raw materials |
|