|
|
| | 4-AMINOBENZANILIDE Basic information |
| | 4-AMINOBENZANILIDE Chemical Properties |
| Melting point | 127-131 °C(lit.) | | Boiling point | 321.2±25.0 °C(Predicted) | | density | 1.244±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 14.36±0.70(Predicted) | | Appearance | White to light brown Solid | | InChI | 1S/C13H12N2O/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,14H2,(H,15,16) | | InChIKey | QHWDUJPWCGEBTH-UHFFFAOYSA-N | | SMILES | Nc1ccc(cc1)C(=O)Nc2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/38-43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | CV2335000 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 4-AMINOBENZANILIDE Usage And Synthesis |
| | 4-AMINOBENZANILIDE Preparation Products And Raw materials |
|