| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 4-(3-thienyl)benzoate Basic information |
| Product Name: | Methyl 4-(3-thienyl)benzoate | | Synonyms: | AKOS BAR-0362;4-(THIOPHEN-3-YL)BENZOIC ACID METHYL ESTER;METHYL 4-(THIOPHEN-3-YL)BENZOATE;RARECHEM AL BF 1418;SALOR-INT L300640-1EA;Methyl 4-(thien-3-yl)benzoate;4-(thien-3-yl)benzoic acid methyl ester;Benzoic acid, 4-(3-thienyl)-, methyl ester | | CAS: | 20608-91-7 | | MF: | C12H10O2S | | MW: | 218.27 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 20608-91-7.mol |  |
| | Methyl 4-(3-thienyl)benzoate Chemical Properties |
| Melting point | 160-164 °C (lit.) | | Boiling point | 310.8±25.0 °C(Predicted) | | density | 1.198±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | Appearance | Off-white to gray Solid | | InChI | 1S/C12H10O2S/c1-14-12(13)10-4-2-9(3-5-10)11-6-7-15-8-11/h2-8H,1H3 | | InChIKey | NTBKCEONBLOPPY-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(cc1)-c2ccsc2 |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | Methyl 4-(3-thienyl)benzoate Usage And Synthesis |
| | Methyl 4-(3-thienyl)benzoate Preparation Products And Raw materials |
|