- 2-Octyl cyanoacetate
-
-
2026-08-07
- CAS:52688-08-1
- Min. Order: 25KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | 2-Octyl cyanoacetate Basic information |
| Product Name: | 2-Octyl cyanoacetate | | Synonyms: | Octan-2-yl 2-cyanoacetate;Acetic acid, cyano-, 1-methylheptyl ester;1-Methylheptyl cyanoacetate;sec-Octyl cyanoacetate;Cyanoacetic acid isooctyl ester;2-OCTYL CYANOACETATE 98.0+%;2-cyanodecanoate;2-OCTYL CYANOACETATE | | CAS: | 52688-08-1 | | MF: | C11H19NO2 | | MW: | 197.27 | | EINECS: | 251-228-4 | | Product Categories: | | | Mol File: | 52688-08-1.mol |  |
| | 2-Octyl cyanoacetate Chemical Properties |
| Boiling point | 241.4±8.0 °C(Predicted) | | density | 0.951±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.94±0.10(Predicted) | | Appearance | Colorless to light green Liquid | | InChI | InChI=1S/C11H19NO2/c1-3-4-5-6-7-10(2)14-11(13)8-9-12/h10H,3-8H2,1-2H3 | | InChIKey | UHQCFCZBVFECRZ-UHFFFAOYSA-N | | SMILES | C(OC(C)CCCCCC)(=O)CC#N |
| RIDADR | UN3276 | | HazardClass | 6.1 |
| | 2-Octyl cyanoacetate Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid | | Uses |
2-Octyl cyanoacetate is the main raw material for the synthesis of α-cyanoacrylate adhesives. α-Cyanoacrylate adhesives are the earliest discovered and most widely used tissue adhesives.
| | Preparation | 2-Octyl cyanoacetate was obtained by direct esterification of cyanoacetic acid with octan-2-ol in a 1:1 molar ratio in the presence of two/three drops of 2% concentrated sulphuric acid as a catalyst and toluene as solvent, to allow for the azeotropic removal of the reaction water.
 |
| | 2-Octyl cyanoacetate Preparation Products And Raw materials |
|