- Felodipine
-
-
2026-08-14
- CAS:86189-69-7
- Min. Order: 10MG
- Purity: ≥98% HPLC
- Supply Ability: 100KG
- FELODIPINE
-
- $15.00
-
2021-07-09
- CAS:86189-69-7
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | Felodipine Basic information |
| Product Name: | Felodipine | | Synonyms: | 4-(2,3-DICHLOROPHENYL)-1,4-DIHYDRO-2,6-DIMETHYL-3,5-PYRIDINECARBOXYLIC ACID METHYL ESTER;4-(2,3-DICHLOROPHENYL)-1,4-DIHYDRO-2,6-DIMETHYL-3,5-PYRIDINEDICARBOXYLIC ACID METHYL ESTER;FLODIL;FELODAY;ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate;Agon sr;Brn 4331472;Felodipina | | CAS: | 86189-69-7 | | MF: | C18H19Cl2NO4 | | MW: | 384.25 | | EINECS: | | | Product Categories: | | | Mol File: | 86189-69-7.mol |  |
| | Felodipine Chemical Properties |
| solubility | DMSO: 28 mg/mL | | form | solid | | color | light yellow | | BCS Class | 2 | | InChI | InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 | | InChIKey | RZTAMFZIAATZDJ-UHFFFAOYSA-N | | SMILES | O=C(OC)C1C(C2=C(Cl)C(Cl)=CC=C2)C(C(=O)OCC)=C(C)NC=1C | | CAS DataBase Reference | 86189-69-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | US7968700 |
| | Felodipine Usage And Synthesis |
| Uses | Vasodilator. | | Brand name | Plendil (AstraZeneca). | | Clinical Use | Calcium-channel blocker:HypertensionAngina | | Drug interactions | Potentially hazardous interactions with other drugs
Aminophylline and theophylline: possibly increased
aminophylline and theophylline concentration.
Anaesthetics: enhanced hypotensive effect.
Antibacterials metabolism possibly inhibited by
clarithromycin, erythromycin and telithromycin.
Antidepressants: enhanced hypotensive effect with
MAOIs.
Antiepileptics: effect reduced by carbamazepine,
barbiturates, phenytoin and primidone.
Antifungals: metabolism inhibited by itraconazole
and ketoconazole; negative inotropic effect possibly
increased with itraconazole.
Antihypertensives: enhanced hypotensive effect,
increased risk of first dose hypotensive effect of postsynaptic alpha-blockers.
Antivirals: concentration possibly increased by
ritonavir; use with caution with telaprevir.
Grapefruit juice: concentration increased - avoid
concomitant use.
Tacrolimus: possibly increased tacrolimus
concentration | | Metabolism | Felodipine is metabolised in the liver and all identified
metabolites are devoid of vasodilating properties.
Approximately 70% of a given dose is excreted as
metabolites in the urine and about 10% with the faeces.
Less than 0.5% of the dose is excreted unchanged in the
urin |
| | Felodipine Preparation Products And Raw materials |
|