| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Diethyl Malonate-13C2 Basic information |
| | Diethyl Malonate-13C2 Chemical Properties |
| Melting point | -51--50 °C (lit.) | | Boiling point | 199 °C (lit.) | | density | 1.067 g/mL at 25 °C | | refractive index | n20/D 1.414(lit.) | | Fp | 212 °F | | storage temp. | Refrigerator | | solubility | Dichloromethane | | form | Oil | | color | Yellow | | InChI | 1S/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3/i6+1,7+1 | | InChIKey | IYXGSMUGOJNHAZ-AKZCFXPHSA-N | | SMILES | CCO[13C](=O)C[13C](=O)OCC | | CAS Number Unlabeled | 105-53-3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids not in Storage Class 3 |
| | Diethyl Malonate-13C2 Usage And Synthesis |
| Chemical Properties | Yellow Oil | | Uses | A labelled diethyl ester of malonic acid which occurs naturally in grapes and strawberries. It is used in the preparation of barbiturates, artificial flavourings, vitamin B1, and vitamin B6 as well as in perfumes. Propanedioic-1,3-13C2 Acid Diethyl Ester is used in the preparation of streptothricin and labeled fatty acids. |
| | Diethyl Malonate-13C2 Preparation Products And Raw materials |
|