|
|
| | 6-Methylheptanol Basic information |
| | 6-Methylheptanol Chemical Properties |
| Melting point | -106°C | | Boiling point | 187°C | | density | 0.8175 | | refractive index | 1.4255 | | storage temp. | Refrigerator | | solubility | Acetonitrile (Slightly), Chloroform (Soluble), Methanol (Slightly) | | form | Oil | | pka | 15.20±0.10(Predicted) | | color | Colourless | | Henry's Law Constant | 1.1×10-1 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | Dielectric constant | 10.199999999999999 | | InChI | InChI=1S/C8H18O/c1-8(2)6-4-3-5-7-9/h8-9H,3-7H2,1-2H3 | | InChIKey | BWDBEAQIHAEVLV-UHFFFAOYSA-N | | SMILES | C(O)CCCCC(C)C | | LogP | 2.721 (est) | | EPA Substance Registry System | 6-Methyl-1-heptanol (1653-40-3) |
| | 6-Methylheptanol Usage And Synthesis |
| Uses | 6-Methylheptanol is a volatile compound used as flavor and fragrance agent. | | Definition | ChEBI: 6-methylheptan-1-ol is a primary alcohol that is heptane which is substituted by a methyl group at position 6 and a hydroxy group at position 1. It has a role as a mammalian metabolite. It is a primary alcohol and a volatile organic compound. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 36, p. 2902, 1971 DOI: 10.1021/jo00818a045 |
| | 6-Methylheptanol Preparation Products And Raw materials |
|