| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Apocholic acid Basic information |
| Product Name: | Apocholic acid | | Synonyms: | 5-BETA,18(14)-CHOLEN-24-OIC ACID-3-ALPHA,12-ALPHA-DIOL;5BETA,8(14)-CHOLEN-24-OIC ACID-3ALPHA,12ALPHA-DIOL;3ALPHA,12ALPHA-DIHYDROXY-5BETA,8(14)-CHOLEN-24-OIC ACID;3ALPHA,12ALPHA-DIHYDROXY-5BETA-CHOL-8(14)EN-24-OIC ACID;8(14),5BETA-CHOLENIC-3ALPHA,12ALPHA-DIOL;8(14), (5-BETA)-CHOLENIC ACID-3-ALPHA, 12-ALPHA-DIOL;3,12-dihydroxy-,(3-alpha,5-beta,12-alpha)-chol-8(14)-en-24-oicaci;3-alpha,12-alpha-dihydroxy-5-beta-chol-8(14)-en-24-oicaci | | CAS: | 641-81-6 | | MF: | C24H38O4 | | MW: | 390.56 | | EINECS: | | | Product Categories: | | | Mol File: | 641-81-6.mol |  |
| | Apocholic acid Chemical Properties |
| Melting point | 175-176 °C(lit.) | | Boiling point | 435.74°C (rough estimate) | | density | 1.0101 (rough estimate) | | refractive index | 1.4460 (estimate) | | pka | 4.75±0.10(Predicted) | | form | powder | | Water Solubility | 0.8g/L(15 ºC) | | InChIKey | XWJTYEGVQBFZHI-CVLMAKDASA-N | | SMILES | OC1[C@@]2(C(CCC2=C3C(C4(C(CC(CC4)O)CC3)C)C1)C(CCC(=O)O)C)C |
| WGK Germany | 3 | | RTECS | FZ5075000 | | Storage Class | 11 - Combustible Solids |
| | Apocholic acid Usage And Synthesis |
| Uses | Apocholic Acid which is derived from Cholic Acid (C432600), which is a choleretic produced by and isolated from liver cells. | | Definition | ChEBI: Apocholic acid is a cholanoid. | | Safety Profile | Questionable carcinogen withexperimental tumorigenic data. When heated todecomposition it emits acrid smoke and irritating fumes. |
| | Apocholic acid Preparation Products And Raw materials |
|