7,8-Dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-one manufacturers
|
| | 7,8-Dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-one Basic information |
| Product Name: | 7,8-Dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-one | | Synonyms: | 1,3-Dioxolo(4,5-g)isoquinolin-5(6H)-one, 7,8-dihydro- (8CI)(9CI);3,4-Dihydro-6,7-methylenedioxy-1(2H)-isoquinolinone;NSC 201020;AKOS 236-14;1,3-Dioxolo[4,5-g]isoquinolin-5(6H)-one, 7,8-dihydro-;Noroxyhydrastinine;7,8-Dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-one | | CAS: | 21796-14-5 | | MF: | C10H9NO3 | | MW: | 191.18 | | EINECS: | | | Product Categories: | | | Mol File: | 21796-14-5.mol | ![7,8-Dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-one Structure](CAS/GIF/21796-14-5.gif) |
| | 7,8-Dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-one Chemical Properties |
| Melting point | 189℃ | | Boiling point | 506.6±50.0 °C(Predicted) | | density | 1.365±0.06 g/cm3 (20 ºC 760 Torr) | | pka | 14.23±0.20(Predicted) | | InChI | InChI=1S/C10H9NO3/c12-10-7-4-9-8(13-5-14-9)3-6(7)1-2-11-10/h3-4H,1-2,5H2,(H,11,12) | | InChIKey | VSOJKDUWYQCWFM-UHFFFAOYSA-N | | SMILES | C1(=O)C2C(=CC3OCOC=3C=2)CCN1 |
| | 7,8-Dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-one Usage And Synthesis |
| Description | This isoquinoline alkaloid from Thalictrum minus var. adiantifolium has been
described by Doskotch and his colleagues. Characterization by chemical methods
and synthesis have shown the base to be 6:7-methylenedioxy-l-oxo-1 :2:3:4-
tetrahydroisoquinoline. | | Uses | Noroxyhydrastinine (compound 1) is an alkaloid. Noroxyhydrastinine can be isolated from the ethanolic extract of the roots of Thalictrum angustifolium[1]. | | References | Doskotch, Schiff, Beal., Tetrahedron, 25,469 (1969) |
| | 7,8-Dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-one Preparation Products And Raw materials |
|