|
|
| | BEPRIDIL HYDROCHLORIDE Basic information |
| Product Name: | BEPRIDIL HYDROCHLORIDE | | Synonyms: | 1978cerm;cordium;BETA-[(2-METHYLPROPOXY)METHYL]-N-PHENYL-N-(PHENYLMETHYL)-1-PYRROLIDINE-ETHANAMINE HYDROCHLORIDE;1-ISOBUTOXY-2-PYRROLIDINO-3-(N-BENZYLANILINO)PROPANE HCL;EPRIDIL HYDROCHLORIDE;Bepricor;1-Pyrrolidineethanamine, beta-((2-methylpropoxy)methyl)-N-phenyl-N-(phenylmethyl)-, monohydrochloride;Einecs 268-472-2 | | CAS: | 68099-86-5 | | MF: | C24H35ClN2O | | MW: | 403.01 | | EINECS: | 268-472-2 | | Product Categories: | API | | Mol File: | 68099-86-5.mol |  |
| | BEPRIDIL HYDROCHLORIDE Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO:59.08(Max Conc. mg/mL);147.34(Max Conc. mM)
DMF:20.0(Max Conc. mg/mL);49.88(Max Conc. mM)
Ethanol:25.0(Max Conc. mg/mL);62.35(Max Conc. mM)
Ethanol:PBS (pH 7.2) (1:2):0.3(Max Conc. mg/mL);0.75(Max Conc. mM) | | form | powder | | color | white | | InChI | 1S/C24H34N2O.ClH/c1-21(2)19-27-20-24(25-15-9-10-16-25)18-26(23-13-7-4-8-14-23)17-22-11-5-3-6-12-22;/h3-8,11-14,21,24H,9-10,15-20H2,1-2H3;1H | | InChIKey | JXBBWYGMTNAYNM-UHFFFAOYSA-N | | SMILES | Cl.CC(C)COCC(CN(Cc1ccccc1)c2ccccc2)N3CCCC3 |
| WGK Germany | 2 | | RTECS | UY1162000 | | Storage Class | 11 - Combustible Solids |
| | BEPRIDIL HYDROCHLORIDE Usage And Synthesis |
| Uses | Bepridil Hydrochloride is a calcium channel blocker. It also activates mitochondrial ATP-sensitive KATP channelsBepridil Hydrochloride is an antiarrhythmic and antihypertensive agent and used for treating atrial fibrillation. | | Definition | ChEBI: The hydrochloride of bepridil. | | Biological Activity | Non-selective calcium channel blocker and class IV antiarrhythmic agent; inhibits Na+-Ca2+ exchange; inhibits growth of brain tumor cells in vitro. | | in vivo | Bepridil hydrochloride (21 mg/kg) reduces heart rate and mean arterial pressure, decreases the mean coronary vascular resistance and increases stroke volume in rats[1]. | | storage | Desiccate at RT |
| | BEPRIDIL HYDROCHLORIDE Preparation Products And Raw materials |
|