|
|
| | 3,7-Dimethoxyflavone Basic information |
| | 3,7-Dimethoxyflavone Chemical Properties |
| form | solid | | InChI | 1S/C17H14O4/c1-19-12-8-9-13-14(10-12)21-16(17(20-2)15(13)18)11-6-4-3-5-7-11/h3-10H,1-2H3 | | InChIKey | CNDZOPXQZSXGSK-UHFFFAOYSA-N | | SMILES | COc1ccc2C(=O)C(OC)=C(Oc2c1)c3ccccc3 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3,7-Dimethoxyflavone Usage And Synthesis |
| | 3,7-Dimethoxyflavone Preparation Products And Raw materials |
|