| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,3-Dibromo-1,4-naphthoquinone Basic information |
| Product Name: | 2,3-Dibromo-1,4-naphthoquinone | | Synonyms: | RARECHEM BW GC 0009;2,3-Dibromo-1,4-naphthoquinone 97%;2,3-dibromo-1,4-dihydronaphthalene-1,4-dione;1,4-Naphthalenedione, 2,3-dibromo-;2,3-DibroMonaphthalene-1,4-dione;2,3-Dibromo-1,4-naphthoquinone | | CAS: | 13243-65-7 | | MF: | C10H4Br2O2 | | MW: | 315.95 | | EINECS: | 236-223-7 | | Product Categories: | C10;Carbonyl Compounds;Ketones | | Mol File: | 13243-65-7.mol |  |
| | 2,3-Dibromo-1,4-naphthoquinone Chemical Properties |
| Melting point | 218-222 °C(lit.) | | Boiling point | 338.6±42.0 °C(Predicted) | | density | 2.145±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C10H4Br2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H | | InChIKey | PSMABVOYZJWFBV-UHFFFAOYSA-N | | SMILES | BrC1=C(Br)C(=O)c2ccccc2C1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,3-Dibromo-1,4-naphthoquinone Usage And Synthesis |
| Uses | 2,3-Dibromo-1,4-naphthoquinone may be used in the synthesis of 3-[3-(2-carboxy-ethylsulfanyl)-1,4-dioxo-1,4-dihydro-naphthalen-2-ylsulfanyl]-propionic acid and NSC 95397 (a protein tyrosine phosphatase antagonist). | | General Description | 2,3-Dibromo-1,4-naphthoquinone is a 2,3-disubstituted 1,4-naphthoquinone. It is a plumbagin derivative and an acaricide. It undergoes photochemical reaction with 2-methoxy-1-alkene to yield derivatives of 2-(2-alkanonyl)-1,4-naphthoquinone. |
| | 2,3-Dibromo-1,4-naphthoquinone Preparation Products And Raw materials |
|