3,5-Dimethyl-2-cyclohexen-1-one manufacturers
|
| | 3,5-Dimethyl-2-cyclohexen-1-one Basic information | | Uses |
| Product Name: | 3,5-Dimethyl-2-cyclohexen-1-one | | Synonyms: | 3,5-DIMETHYL-2-CYCLOHEXEN-1-ONE;3,5-Dimethyl-2-cyclohexene-1-one;3,5-dimethylcyclohex-2-en-1-one;3,5-Dimethyl-2-cyclohexen-1-on;3,5-Dimethyl-2-cyclohexen-1-one,99%;3,5-diMethylcyclohex-2-enone;2-Cyclohexen-1-one, 3,5-dimethyl- | | CAS: | 1123-09-7 | | MF: | C8H12O | | MW: | 124.18 | | EINECS: | 214-369-2 | | Product Categories: | C7 to C8;Carbonyl Compounds;Ketones;Building Blocks;C7 to C8;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks | | Mol File: | 1123-09-7.mol |  |
| | 3,5-Dimethyl-2-cyclohexen-1-one Chemical Properties |
| Melting point | 166 °C(Solv: ethanol (64-17-5)) | | Boiling point | 211-212 °C (lit.) | | density | 0.881 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.483(lit.) | | Fp | 175 °F | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | InChI | InChI=1S/C8H12O/c1-6-3-7(2)5-8(9)4-6/h4,7H,3,5H2,1-2H3 | | InChIKey | NOQKKFBBAODEHN-UHFFFAOYSA-N | | SMILES | C1(=O)CC(C)CC(C)=C1 | | LogP | 1.141 (est) | | NIST Chemistry Reference | 2-Cyclohexen-1-one, 3,5-dimethyl-(1123-09-7) |
| Hazard Codes | Xn | | Risk Statements | 36-20/21/22 | | Safety Statements | 36/37/39-26 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 3,5-Dimethyl-2-cyclohexen-1-one Usage And Synthesis |
| Uses | 3,5-Dimethyl-2-cyclohexen-1-one can be used as a starting material for the synthesis of the intermediate 3,5-dimethyl-2-cyclohexen-1-one. | | Chemical Properties | CLEAR COLOURLESS TO LIGHT YELLOW LIQUID | | Uses | 3,5-Dimethyl-2-cyclohexen-1-one can be used as a starting material for the synthesis of the intermediate 3,5-dimethyl-2-cyclohexen-1-one. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 42, p. 1664, 1977 DOI: 10.1021/jo00429a048 |
| | 3,5-Dimethyl-2-cyclohexen-1-one Preparation Products And Raw materials |
|