|
|
| | 2,6-DIMETHYLBENZOQUINONE Basic information |
| Product Name: | 2,6-DIMETHYLBENZOQUINONE | | Synonyms: | 2,5-Cyclohexadiene-1,4-dione,2,6-dimethyl-;2,6-DIMETHYL-P-BENZOQUINONE;2,6-DIMETHYL-P-QUINONE;2,6-DIMETHYL-1,4-BENZOQUINONE;2,6-DIMETHYL-2,5-CYCLOHEXADIENE-1,4-DIONE;Dimethylpbenzoquinone;2,6-DIMETHYL-PARA-BENZOQUINONE;naphthyridine-3-carbonitrile | | CAS: | 527-61-7 | | MF: | C8H8O2 | | MW: | 136.15 | | EINECS: | 208-420-8 | | Product Categories: | C7 to C8;Carbonyl Compounds;Ketones;Anthraquinones, Hydroquinones and Quinones;Benzoquinones;Benzoquinones, etc. (Charge Transfer Complexes);Charge Transfer Complexes for Organic Metals;Functional Materials | | Mol File: | 527-61-7.mol |  |
| | 2,6-DIMETHYLBENZOQUINONE Chemical Properties |
| Melting point | 71-73 °C(lit.) | | Boiling point | 201℃ | | density | 1.115 | | refractive index | 1. | | Fp | 71℃ | | form | Needle-Like Crystalline Solid | | color | Yellow to brown | | Water Solubility | Soluble in chloroform. Insoluble in water. | | BRN | 2041345 | | Stability: | Stable. Combustible. Incompatible with oxidizing agents. | | InChI | InChI=1S/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 | | InChIKey | SENUUPBBLQWHMF-UHFFFAOYSA-N | | SMILES | C1(=O)C(C)=CC(=O)C=C1C | | CAS DataBase Reference | 527-61-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | RTECS | DK4825000 | | HS Code | 29146990 | | Storage Class | 11 - Combustible Solids |
| | 2,6-DIMETHYLBENZOQUINONE Usage And Synthesis |
| Chemical Properties | yellow solid | | Uses | 2,6-Dimethyl-p-benzoquinone is used as organic intermediates. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 54, p. 728, 1989 DOI: 10.1021/jo00264a047 |
| | 2,6-DIMETHYLBENZOQUINONE Preparation Products And Raw materials |
| Raw materials | 2,5-Cyclohexadiene-1,4-dione, 2-hydroxy-3,5-dimethyl--->1,4-Ethanonaphthalene-6,10(4H)-dione,1,4a,5,8a-tetrahydro-5,9-dihydroxy-1,5,7,9-tetramethyl--->1-Cyclohexene-1-carboxaldehyde, 5-methyl-3-oxo--->3,5-Dimethyl-2-cyclohexen-1-one-->4-CHLORO-2,6-DIMETHYLPHENOL-->2,6-DIMETHYLBENZAMIDE-->4-Bromo-2,6-dimethylphenol | | Preparation Products | 3,5-Dimethyl-4-hydroxybenzaldehyde-->2,6-Dimethyl-4-aminophenol-->3,3',5,5'-Tetramethyldiphenoquinone-->2,6-DIMETHYL-4-NITROPHENOL-->2,6-DIMETHYLHYDROQUINONE |
|