|
|
| | 6-Amino-3,4-methylenedioxyacetophenone Basic information |
| | 6-Amino-3,4-methylenedioxyacetophenone Chemical Properties |
| Melting point | 168-171 °C | | Boiling point | 158 °C (30 mmHg) | | density | 1.2822 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | 2-8°C, protect from light | | solubility | soluble in Dimethylformamide | | pka | 2.48±0.20(Predicted) | | form | Fine Granular Crystalline Powder | | color | Brown | | InChI | InChI=1S/C9H9NO3/c1-5(11)6-2-8-9(3-7(6)10)13-4-12-8/h2-3H,4,10H2,1H3 | | InChIKey | DWTHYSZSRJOMSC-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(N)C=C2OCOC2=C1)C |
| | 6-Amino-3,4-methylenedioxyacetophenone Usage And Synthesis |
| Chemical Properties | brown fine granular crystalline powder |
| | 6-Amino-3,4-methylenedioxyacetophenone Preparation Products And Raw materials |
|