| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Trimethylene bis(4-aminobenzoate) Basic information |
| | Trimethylene bis(4-aminobenzoate) Chemical Properties |
| Melting point | 124-127 °C(lit.) | | Boiling point | 454.02°C (rough estimate) | | density | 1.14 g/mL at 140 °C (specific gravity)(lit.) | | vapor pressure | 9.998hPa at 21.1℃ | | refractive index | 1.5486 (estimate) | | storage temp. | 2-8°C, protect from light | | solubility | almost transparency in Acetone | | pka | 2.61±0.10(Predicted) | | form | powder (Granular) | | color | White to Yellow to Orange | | Water Solubility | 4mg/L at 25℃ | | InChI | 1S/C17H18N2O4/c18-14-6-2-12(3-7-14)16(20)22-10-1-11-23-17(21)13-4-8-15(19)9-5-13/h2-9H,1,10-11,18-19H2 | | InChIKey | YPACMOORZSDQDQ-UHFFFAOYSA-N | | SMILES | Nc1ccc(cc1)C(=O)OCCCOC(=O)c2ccc(N)cc2 | | LogP | 2.63 at 25℃ | | CAS DataBase Reference | 57609-64-0(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Propanediol, bis(4-aminobenzoate) (57609-64-0) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2922.49.3700 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Trimethylene bis(4-aminobenzoate) Usage And Synthesis |
| Uses | A safe, high performance reactant with polyurethane and epoxide prepolymers. | | General Description | Non-hygroscopic, forms urethanes with good hydrolytic stability, dry heat aging and chemical and environmental resistance. | | Flammability and Explosibility | Not classified |
| | Trimethylene bis(4-aminobenzoate) Preparation Products And Raw materials |
|