|
|
| | BIS(TRIMETHYLSILYL)CHLOROMETHANE Basic information |
| Product Name: | BIS(TRIMETHYLSILYL)CHLOROMETHANE | | Synonyms: | BIS(TRIMETHYLSILYL)CHLOROMETHANE;BIS(TRIMETHYLSILYL)METHYL CHLORIDE;Chloro-bis(trimethylsilyl)methane;Chlorobis(trimethylsilyl)methane 97%;Chloro-bis-trimethylsilanyl-methane;(Chloromethylene)bis(trimethylsilane);Silane, 1,1'-(chloromethylene)bis[1,1,1-trimethyl-;chloro(trimethylsilyl)methyl]-trimethylsilane | | CAS: | 5926-35-2 | | MF: | C7H19ClSi2 | | MW: | 194.85 | | EINECS: | | | Product Categories: | | | Mol File: | 5926-35-2.mol |  |
| | BIS(TRIMETHYLSILYL)CHLOROMETHANE Chemical Properties |
| Boiling point | 57-60 °C/15 mmHg (lit.) | | density | 0.892 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.449(lit.) | | Fp | 120 °F | | solubility | soluble in common organic solvents (DMF, THF,
Et2O, CH2Cl2). | | form | liquid | | Specific Gravity | 0.892 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | BRN | 1736681 | | InChI | 1S/C7H19ClSi2/c1-9(2,3)7(8)10(4,5)6/h7H,1-6H3 | | InChIKey | XNJGZHVYPBNLEB-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)C(Cl)[Si](C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | F | 21 | | TSCA | No | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | BIS(TRIMETHYLSILYL)CHLOROMETHANE Usage And Synthesis |
| Physical properties | bp 57–60°C(15 mmHg); flash point 48 °C;
d 0.892 gmL1 (25 °C). | | Uses | Silane, 1,1-(Chloromethylene)bis[1,1,1]-
trimethyl- can be used as versatile C1 building block; broad application in Peterson olefination
reactions; Grignard reagent participates readily in Kumada
cross-coupling reactions with aryl and vinyl halides; useful in
synthesis of methylenephosphine analogs and as sterically demanding
ligand for a number of main group and transition metal
complexes. | | Uses | Chlorobis(trimethylsilyl)methane can be used as a reagent for the preparation of:
- Para-bis(trimethylsilyl)ethylstyrene (PBTES) monomer, which is used to synthesize corresponding network polymer of styrene.
- Bis(trimethylsilyl)methyl magnesium chloride (Grignard reagent), which is used in the synthesis of bis(trimethylsilyl) allyl compounds by reacting with alkenyl bromide via the Kumada coupling reaction.
- N-[Bis(trimethylsilyl)methyl]heterocumulenes.
| | Preparation | a convenient one-pot procedure has been
developed by Kemp and Cowley in which trimethylsilylchloride
reacts with dichloromethane in the presence of nBuLi
at 110°Cto give bis(trimethylsilyl)dichloromethane.1 This
intermediate is sequentially treated with nBuLi and ethanol
to yield chlorobis(trimethylsilyl)methane. A number of other
syntheses have been described |
| | BIS(TRIMETHYLSILYL)CHLOROMETHANE Preparation Products And Raw materials |
|